C10H16N2O4S — CID 88785818
[4-amino-4-oxo-2-(sulfanylmethyl)butanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 88785818) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is [4-amino-4-oxo-2-(sulfanylmethyl)butanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [4-amino-4-oxo-2-(sulfanylmethyl)butanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88785818 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | [4-amino-4-oxo-2-(sulfanylmethyl)butanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | NC(=O)CC(CS)C(=O)OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H16N2O4S/c11-8(13)4-6(5-17)9(14)16-10(15)7-2-1-3-12-7/h6-7,12,17H,1-5H2,(H2,11,13)/t6?,7-/m0/s1 |
| InChIKey | YLIJAWXOLKJCMI-MLWJPKLSSA-N |
| XLogP | -0.77 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|