C11H19NO8 — CID 87509221
[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 87509221) has the molecular formula C11H19NO8 and a molecular weight of 293.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87509221 |
| Molecular Formula | C11H19NO8 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | [(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H19NO8/c13-4-6(14)7(15)8(16)9(17)11(19)20-10(18)5-2-1-3-12-5/h5-9,12-17H,1-4H2/t5-,6+,7+,8-,9+/m0/s1 |
| InChIKey | CNXHPJQWUAVQDX-JTPBWFLFSA-N |
| XLogP | -3.76 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|