C11H21NO8 — CID 174433302
2,3,4,5,6-pentahydroxyhexanal;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 174433302) has the molecular formula C11H21NO8 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;(2S)-pyrrolidine-2-carboxylic acid.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;(2S)-pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 174433302 |
| Molecular Formula | C11H21NO8 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.C5H9NO2/c7-1-3(9)5(11)6(12)4(10)2-8;7-5(8)4-2-1-3-6-4/h1,3-6,8-12H,2H2;4,6H,1-3H2,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | YEYBNBALIONZOA-VWMHFEHESA-N |
| XLogP | -3.56 |
| TPSA | 167.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|