About formic acid;(2S)-pyrrolidine-2-carboxylic acid
formic acid;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 67621740) has the molecular formula C6H11NO4
and a molecular weight of 161.16 g/mol. Its IUPAC name is formic acid;(2S)-pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | formic acid;(2S)-pyrrolidine-2-carboxylic acid |
| PubChem CID | 67621740 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | formic acid;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1.O=CO |
| InChI | InChI=1S/C5H9NO2.CH2O2/c7-5(8)4-2-1-3-6-4;2-1-3/h4,6H,1-3H2,(H,7,8);1H,(H,2,3)/t4-;/m0./s1 |
| InChIKey | FAPVTLNZAZKHIH-WCCKRBBISA-N |
| XLogP | -0.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;(2S)-pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;(2S)-pyrrolidine-2-carboxylic acid?
The IUPAC name of formic acid;(2S)-pyrrolidine-2-carboxylic acid (CID 67621740) is formic acid;(2S)-pyrrolidine-2-carboxylic acid.
What is the SMILES notation for formic acid;(2S)-pyrrolidine-2-carboxylic acid?
The canonical SMILES for formic acid;(2S)-pyrrolidine-2-carboxylic acid is O=C(O)[C@@H]1CCCN1.O=CO.
What is the InChIKey of formic acid;(2S)-pyrrolidine-2-carboxylic acid?
The InChIKey is FAPVTLNZAZKHIH-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO2.CH2O2/c7-5(8)4-2-1-3-6-4;2-1-3/h4,6H,1-3H2,(H,7,8);1H,(H,2,3)/t4-;/m0./s1.
What are the key properties of formic acid;(2S)-pyrrolidine-2-carboxylic acid?
formic acid;(2S)-pyrrolidine-2-carboxylic acid has a molecular weight of 161.16 g/mol, XLogP of -0.48, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;(2S)-pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 67621740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).