C17H26O6SSi — CID 87960766
2-(3-triethoxysilylpropylsulfanylcarbonyl)benzoic acid (PubChem CID 87960766) has the molecular formula C17H26O6SSi and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-(3-triethoxysilylpropylsulfanylcarbonyl)benzoic acid.
| Compound Name | 2-(3-triethoxysilylpropylsulfanylcarbonyl)benzoic acid |
|---|---|
| PubChem CID | 87960766 |
| Molecular Formula | C17H26O6SSi |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-(3-triethoxysilylpropylsulfanylcarbonyl)benzoic acid |
| SMILES | CCO[Si](CCCSC(=O)c1ccccc1C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C17H26O6SSi/c1-4-21-25(22-5-2,23-6-3)13-9-12-24-17(20)15-11-8-7-10-14(15)16(18)19/h7-8,10-11H,4-6,9,12-13H2,1-3H3,(H,18,19) |
| InChIKey | MQLSYBGWBCRADD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|