C24H40O6SSi — CID 162074033
tert-butyl 3-benzyl-4-oxo-4-(3-triethoxysilylpropylsulfanyl)butanoate (PubChem CID 162074033) has the molecular formula C24H40O6SSi and a molecular weight of 484.73 g/mol. Its IUPAC name is tert-butyl 3-benzyl-4-oxo-4-(3-triethoxysilylpropylsulfanyl)butanoate.
| Compound Name | tert-butyl 3-benzyl-4-oxo-4-(3-triethoxysilylpropylsulfanyl)butanoate |
|---|---|
| PubChem CID | 162074033 |
| Molecular Formula | C24H40O6SSi |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | tert-butyl 3-benzyl-4-oxo-4-(3-triethoxysilylpropylsulfanyl)butanoate |
| SMILES | CCO[Si](CCCSC(=O)C(CC(=O)OC(C)(C)C)Cc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C24H40O6SSi/c1-7-27-32(28-8-2,29-9-3)17-13-16-31-23(26)21(18-20-14-11-10-12-15-20)19-22(25)30-24(4,5)6/h10-12,14-15,21H,7-9,13,16-19H2,1-6H3 |
| InChIKey | ZBLWLDDFUVBXBD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|