C22H30O4Si — CID 141118396
phenyl-[2-(3-triethoxysilylpropyl)phenyl]methanone (PubChem CID 141118396) has the molecular formula C22H30O4Si and a molecular weight of 386.56 g/mol. Its IUPAC name is phenyl-[2-(3-triethoxysilylpropyl)phenyl]methanone.
| Compound Name | phenyl-[2-(3-triethoxysilylpropyl)phenyl]methanone |
|---|---|
| PubChem CID | 141118396 |
| Molecular Formula | C22H30O4Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | phenyl-[2-(3-triethoxysilylpropyl)phenyl]methanone |
| SMILES | CCO[Si](CCCc1ccccc1C(=O)c1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C22H30O4Si/c1-4-24-27(25-5-2,26-6-3)18-12-16-19-13-10-11-17-21(19)22(23)20-14-8-7-9-15-20/h7-11,13-15,17H,4-6,12,16,18H2,1-3H3 |
| InChIKey | RCSNQFZIWROWAZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|