C28H44O6Si — CID 19070360
2-hydroxy-2-phenyl-1-[2-(2-triethoxysilylethyl)phenyl]ethanone;2-propan-2-yloxypropane (PubChem CID 19070360) has the molecular formula C28H44O6Si and a molecular weight of 504.74 g/mol. Its IUPAC name is 2-hydroxy-2-phenyl-1-[2-(2-triethoxysilylethyl)phenyl]ethanone;2-propan-2-yloxypropane.
| Compound Name | 2-hydroxy-2-phenyl-1-[2-(2-triethoxysilylethyl)phenyl]ethanone;2-propan-2-yloxypropane |
|---|---|
| PubChem CID | 19070360 |
| Molecular Formula | C28H44O6Si |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 2-hydroxy-2-phenyl-1-[2-(2-triethoxysilylethyl)phenyl]ethanone;2-propan-2-yloxypropane |
| SMILES | CC(C)OC(C)C.CCO[Si](CCc1ccccc1C(=O)C(O)c1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C22H30O5Si.C6H14O/c1-4-25-28(26-5-2,27-6-3)17-16-18-12-10-11-15-20(18)22(24)21(23)19-13-8-7-9-14-19;1-5(2)7-6(3)4/h7-15,21,23H,4-6,16-17H2,1-3H3;5-6H,1-4H3 |
| InChIKey | MZJDDHGDKJPTSQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|