C18H28O7Si — CID 101047419
dimethyl 4-(2-triethoxysilylethyl)benzene-1,3-dicarboxylate (PubChem CID 101047419) has the molecular formula C18H28O7Si and a molecular weight of 384.50 g/mol. Its IUPAC name is dimethyl 4-(2-triethoxysilylethyl)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 4-(2-triethoxysilylethyl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101047419 |
| Molecular Formula | C18H28O7Si |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | dimethyl 4-(2-triethoxysilylethyl)benzene-1,3-dicarboxylate |
| SMILES | CCO[Si](CCc1ccc(C(=O)OC)cc1C(=O)OC)(OCC)OCC |
| InChI | InChI=1S/C18H28O7Si/c1-6-23-26(24-7-2,25-8-3)12-11-14-9-10-15(17(19)21-4)13-16(14)18(20)22-5/h9-10,13H,6-8,11-12H2,1-5H3 |
| InChIKey | QSHJWHUXQAZKCM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|