C17H15FO4 — CID 18476032
dimethyl 4-[(4-fluorophenyl)methyl]benzene-1,3-dicarboxylate (PubChem CID 18476032) has the molecular formula C17H15FO4 and a molecular weight of 302.30 g/mol. Its IUPAC name is dimethyl 4-[(4-fluorophenyl)methyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 4-[(4-fluorophenyl)methyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 18476032 |
| Molecular Formula | C17H15FO4 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | dimethyl 4-[(4-fluorophenyl)methyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1ccc(Cc2ccc(F)cc2)c(C(=O)OC)c1 |
| InChI | InChI=1S/C17H15FO4/c1-21-16(19)13-6-5-12(15(10-13)17(20)22-2)9-11-3-7-14(18)8-4-11/h3-8,10H,9H2,1-2H3 |
| InChIKey | ZQXPBGPNFAFRRA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |