C18H16FNO5 — CID 139404513
dimethyl 4-[(E)-C-(4-fluorophenyl)-N-methoxycarbonimidoyl]benzene-1,3-dicarboxylate (PubChem CID 139404513) has the molecular formula C18H16FNO5 and a molecular weight of 345.33 g/mol. Its IUPAC name is dimethyl 4-[(E)-C-(4-fluorophenyl)-N-methoxycarbonimidoyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 4-[(E)-C-(4-fluorophenyl)-N-methoxycarbonimidoyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 139404513 |
| Molecular Formula | C18H16FNO5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | dimethyl 4-[(E)-C-(4-fluorophenyl)-N-methoxycarbonimidoyl]benzene-1,3-dicarboxylate |
| SMILES | CO/N=C(\c1ccc(F)cc1)c1ccc(C(=O)OC)cc1C(=O)OC |
| InChI | InChI=1S/C18H16FNO5/c1-23-17(21)12-6-9-14(15(10-12)18(22)24-2)16(20-25-3)11-4-7-13(19)8-5-11/h4-10H,1-3H3/b20-16+ |
| InChIKey | NRYBQMUNHGJUBF-CAPFRKAQSA-N |
| XLogP | 2.80 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|