About methyl 4-triethoxysilylbenzoate
methyl 4-triethoxysilylbenzoate (PubChem CID 12006361) has the molecular formula C14H22O5Si
and a molecular weight of 298.41 g/mol. Its IUPAC name is methyl 4-triethoxysilylbenzoate.
Molecular Properties
| Compound Name | methyl 4-triethoxysilylbenzoate |
| PubChem CID | 12006361 |
| Molecular Formula | C14H22O5Si |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | methyl 4-triethoxysilylbenzoate |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C14H22O5Si/c1-5-17-20(18-6-2,19-7-3)13-10-8-12(9-11-13)14(15)16-4/h8-11H,5-7H2,1-4H3 |
| InChIKey | MNOUFCPSIPDMIK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-triethoxysilylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-triethoxysilylbenzoate?
The IUPAC name of methyl 4-triethoxysilylbenzoate (CID 12006361) is methyl 4-triethoxysilylbenzoate.
What is the SMILES notation for methyl 4-triethoxysilylbenzoate?
The canonical SMILES for methyl 4-triethoxysilylbenzoate is CCO[Si](OCC)(OCC)c1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-triethoxysilylbenzoate?
The InChIKey is MNOUFCPSIPDMIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O5Si/c1-5-17-20(18-6-2,19-7-3)13-10-8-12(9-11-13)14(15)16-4/h8-11H,5-7H2,1-4H3.
What are the key properties of methyl 4-triethoxysilylbenzoate?
methyl 4-triethoxysilylbenzoate has a molecular weight of 298.41 g/mol, XLogP of 1.73, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-triethoxysilylbenzoate is sourced from PubChem (CID 12006361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).