About ethoxy(trimethyl)silane;methyl benzoate
ethoxy(trimethyl)silane;methyl benzoate (PubChem CID 91180329) has the molecular formula C13H22O3Si
and a molecular weight of 254.40 g/mol. Its IUPAC name is ethoxy(trimethyl)silane;methyl benzoate.
Molecular Properties
| Compound Name | ethoxy(trimethyl)silane;methyl benzoate |
| PubChem CID | 91180329 |
| Molecular Formula | C13H22O3Si |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | ethoxy(trimethyl)silane;methyl benzoate |
| SMILES | CCO[Si](C)(C)C.COC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8O2.C5H14OSi/c1-10-8(9)7-5-3-2-4-6-7;1-5-6-7(2,3)4/h2-6H,1H3;5H2,1-4H3 |
| InChIKey | UFEQJYXUIMWNOU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethoxy(trimethyl)silane;methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy(trimethyl)silane;methyl benzoate?
The IUPAC name of ethoxy(trimethyl)silane;methyl benzoate (CID 91180329) is ethoxy(trimethyl)silane;methyl benzoate.
What is the SMILES notation for ethoxy(trimethyl)silane;methyl benzoate?
The canonical SMILES for ethoxy(trimethyl)silane;methyl benzoate is CCO[Si](C)(C)C.COC(=O)c1ccccc1.
What is the InChIKey of ethoxy(trimethyl)silane;methyl benzoate?
The InChIKey is UFEQJYXUIMWNOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C5H14OSi/c1-10-8(9)7-5-3-2-4-6-7;1-5-6-7(2,3)4/h2-6H,1H3;5H2,1-4H3.
What are the key properties of ethoxy(trimethyl)silane;methyl benzoate?
ethoxy(trimethyl)silane;methyl benzoate has a molecular weight of 254.40 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy(trimethyl)silane;methyl benzoate is sourced from PubChem (CID 91180329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).