C13H14O5 — CID 71377210
dimethyl 4-prop-2-enoxybenzene-1,3-dicarboxylate (PubChem CID 71377210) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is dimethyl 4-prop-2-enoxybenzene-1,3-dicarboxylate.
| Compound Name | dimethyl 4-prop-2-enoxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71377210 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | dimethyl 4-prop-2-enoxybenzene-1,3-dicarboxylate |
| SMILES | C=CCOc1ccc(C(=O)OC)cc1C(=O)OC |
| InChI | InChI=1S/C13H14O5/c1-4-7-18-11-6-5-9(12(14)16-2)8-10(11)13(15)17-3/h4-6,8H,1,7H2,2-3H3 |
| InChIKey | SIYHJEGWZKNRIY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|