C11H10F2O5 — CID 173255270
dimethyl 4-(difluoromethoxy)benzene-1,3-dicarboxylate (PubChem CID 173255270) has the molecular formula C11H10F2O5 and a molecular weight of 260.19 g/mol. Its IUPAC name is dimethyl 4-(difluoromethoxy)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 4-(difluoromethoxy)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 173255270 |
| Molecular Formula | C11H10F2O5 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | dimethyl 4-(difluoromethoxy)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1ccc(OC(F)F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C11H10F2O5/c1-16-9(14)6-3-4-8(18-11(12)13)7(5-6)10(15)17-2/h3-5,11H,1-2H3 |
| InChIKey | GDFNVZLGKQRULZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |