About 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone
1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone (PubChem CID 174672738) has the molecular formula C22H30O3
and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone.
Molecular Properties
| Compound Name | 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone |
| PubChem CID | 174672738 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone |
| SMILES | CCCCOCCCC.O=C(c1ccccc1)c1ccccc1CO |
| InChI | InChI=1S/C14H12O2.C8H18O/c15-10-12-8-4-5-9-13(12)14(16)11-6-2-1-3-7-11;1-3-5-7-9-8-6-4-2/h1-9,15H,10H2;3-8H2,1-2H3 |
| InChIKey | VFKCOXBUQXUQLB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone?
The IUPAC name of 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone (CID 174672738) is 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone.
What is the SMILES notation for 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone?
The canonical SMILES for 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone is CCCCOCCCC.O=C(c1ccccc1)c1ccccc1CO.
What is the InChIKey of 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone?
The InChIKey is VFKCOXBUQXUQLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2.C8H18O/c15-10-12-8-4-5-9-13(12)14(16)11-6-2-1-3-7-11;1-3-5-7-9-8-6-4-2/h1-9,15H,10H2;3-8H2,1-2H3.
What are the key properties of 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone?
1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone has a molecular weight of 342.48 g/mol, XLogP of 5.01, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxybutane;[2-(hydroxymethyl)phenyl]-phenylmethanone is sourced from PubChem (CID 174672738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).