C24H47NO6Si2 — CID 69038548
2,3-bis(3-triethoxysilylpropyl)aniline (PubChem CID 69038548) has the molecular formula C24H47NO6Si2 and a molecular weight of 501.81 g/mol. Its IUPAC name is 2,3-bis(3-triethoxysilylpropyl)aniline.
| Compound Name | 2,3-bis(3-triethoxysilylpropyl)aniline |
|---|---|
| PubChem CID | 69038548 |
| Molecular Formula | C24H47NO6Si2 |
| Molecular Weight | 501.81 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 2,3-bis(3-triethoxysilylpropyl)aniline |
| SMILES | CCO[Si](CCCc1cccc(N)c1CCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C24H47NO6Si2/c1-7-26-32(27-8-2,28-9-3)20-14-17-22-16-13-19-24(25)23(22)18-15-21-33(29-10-4,30-11-5)31-12-6/h13,16,19H,7-12,14-15,17-18,20-21,25H2,1-6H3 |
| InChIKey | CCXREHIPSLADFP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.81 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|