C20H34N2O2 — CID 174438100
ethyl 3-[2-amino-6-[3-[di(propan-2-yl)amino]propyl]phenyl]propanoate (PubChem CID 174438100) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is ethyl 3-[2-amino-6-[3-[di(propan-2-yl)amino]propyl]phenyl]propanoate.
| Compound Name | ethyl 3-[2-amino-6-[3-[di(propan-2-yl)amino]propyl]phenyl]propanoate |
|---|---|
| PubChem CID | 174438100 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | ethyl 3-[2-amino-6-[3-[di(propan-2-yl)amino]propyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1c(N)cccc1CCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C20H34N2O2/c1-6-24-20(23)13-12-18-17(9-7-11-19(18)21)10-8-14-22(15(2)3)16(4)5/h7,9,11,15-16H,6,8,10,12-14,21H2,1-5H3 |
| InChIKey | PUTGUJBMGXBLIE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|