C36H59NO5 — CID 143766066
ethane;ethyl 4-[2-(3-ethoxy-3-oxopropyl)-3-[6-(N,3,5-trimethylanilino)hexyl]phenoxy]butanoate (PubChem CID 143766066) has the molecular formula C36H59NO5 and a molecular weight of 585.87 g/mol. Its IUPAC name is ethane;ethyl 4-[2-(3-ethoxy-3-oxopropyl)-3-[6-(N,3,5-trimethylanilino)hexyl]phenoxy]butanoate.
| Compound Name | ethane;ethyl 4-[2-(3-ethoxy-3-oxopropyl)-3-[6-(N,3,5-trimethylanilino)hexyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 143766066 |
| Molecular Formula | C36H59NO5 |
| Molecular Weight | 585.87 g/mol |
| Exact Mass | 585.44 |
| IUPAC Name | ethane;ethyl 4-[2-(3-ethoxy-3-oxopropyl)-3-[6-(N,3,5-trimethylanilino)hexyl]phenoxy]butanoate |
| SMILES | CC.CC.CCOC(=O)CCCOc1cccc(CCCCCCN(C)c2cc(C)cc(C)c2)c1CCC(=O)OCC |
| InChI | InChI=1S/C32H47NO5.2C2H6/c1-6-36-31(34)17-13-21-38-30-16-12-15-27(29(30)18-19-32(35)37-7-2)14-10-8-9-11-20-33(5)28-23-25(3)22-26(4)24-28;2*1-2/h12,15-16,22-24H,6-11,13-14,17-21H2,1-5H3;2*1-2H3 |
| InChIKey | DSZIKXPLQVRNSH-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.87 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|