C39H52O8S — CID 67338934
tert-butyl 3-[6-[3-(4-ethoxy-4-oxobutoxy)-2-(3-ethoxy-3-oxopropyl)phenyl]hexoxy]-5-(4-methylthiophen-3-yl)benzoate (PubChem CID 67338934) has the molecular formula C39H52O8S and a molecular weight of 680.90 g/mol. Its IUPAC name is tert-butyl 3-[6-[3-(4-ethoxy-4-oxobutoxy)-2-(3-ethoxy-3-oxopropyl)phenyl]hexoxy]-5-(4-methylthiophen-3-yl)benzoate.
| Compound Name | tert-butyl 3-[6-[3-(4-ethoxy-4-oxobutoxy)-2-(3-ethoxy-3-oxopropyl)phenyl]hexoxy]-5-(4-methylthiophen-3-yl)benzoate |
|---|---|
| PubChem CID | 67338934 |
| Molecular Formula | C39H52O8S |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | tert-butyl 3-[6-[3-(4-ethoxy-4-oxobutoxy)-2-(3-ethoxy-3-oxopropyl)phenyl]hexoxy]-5-(4-methylthiophen-3-yl)benzoate |
| SMILES | CCOC(=O)CCCOc1cccc(CCCCCCOc2cc(C(=O)OC(C)(C)C)cc(-c3cscc3C)c2)c1CCC(=O)OCC |
| InChI | InChI=1S/C39H52O8S/c1-7-43-36(40)18-14-22-46-35-17-13-16-29(33(35)19-20-37(41)44-8-2)15-11-9-10-12-21-45-32-24-30(34-27-48-26-28(34)3)23-31(25-32)38(42)47-39(4,5)6/h13,16-17,23-27H,7-12,14-15,18-22H2,1-6H3 |
| InChIKey | IPXSQHRLKBMTJF-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|