C28H42O10 — CID 11512186
ditert-butyl 4,6-bis(4-ethoxy-4-oxobutoxy)benzene-1,3-dicarboxylate (PubChem CID 11512186) has the molecular formula C28H42O10 and a molecular weight of 538.63 g/mol. Its IUPAC name is ditert-butyl 4,6-bis(4-ethoxy-4-oxobutoxy)benzene-1,3-dicarboxylate.
| Compound Name | ditert-butyl 4,6-bis(4-ethoxy-4-oxobutoxy)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11512186 |
| Molecular Formula | C28H42O10 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | ditert-butyl 4,6-bis(4-ethoxy-4-oxobutoxy)benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)CCCOc1cc(OCCCC(=O)OCC)c(C(=O)OC(C)(C)C)cc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H42O10/c1-9-33-23(29)13-11-15-35-21-18-22(36-16-12-14-24(30)34-10-2)20(26(32)38-28(6,7)8)17-19(21)25(31)37-27(3,4)5/h17-18H,9-16H2,1-8H3 |
| InChIKey | AANJOHVXXXOBCY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|