C29H37BrO8 — CID 140540570
tert-butyl 3-bromo-5-[[3-(4-ethoxy-4-oxobutoxy)-2-(3-ethoxy-3-oxopropyl)phenyl]methoxy]benzoate (PubChem CID 140540570) has the molecular formula C29H37BrO8 and a molecular weight of 593.51 g/mol. Its IUPAC name is tert-butyl 3-bromo-5-[[3-(4-ethoxy-4-oxobutoxy)-2-(3-ethoxy-3-oxopropyl)phenyl]methoxy]benzoate.
| Compound Name | tert-butyl 3-bromo-5-[[3-(4-ethoxy-4-oxobutoxy)-2-(3-ethoxy-3-oxopropyl)phenyl]methoxy]benzoate |
|---|---|
| PubChem CID | 140540570 |
| Molecular Formula | C29H37BrO8 |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | tert-butyl 3-bromo-5-[[3-(4-ethoxy-4-oxobutoxy)-2-(3-ethoxy-3-oxopropyl)phenyl]methoxy]benzoate |
| SMILES | CCOC(=O)CCCOc1cccc(COc2cc(Br)cc(C(=O)OC(C)(C)C)c2)c1CCC(=O)OCC |
| InChI | InChI=1S/C29H37BrO8/c1-6-34-26(31)12-9-15-36-25-11-8-10-20(24(25)13-14-27(32)35-7-2)19-37-23-17-21(16-22(30)18-23)28(33)38-29(3,4)5/h8,10-11,16-18H,6-7,9,12-15,19H2,1-5H3 |
| InChIKey | LTLPIKNNYXRXOA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|