C46H68O12 — CID 157379794
ethyl 4-[2-(3-ethoxy-3-oxopropyl)-3-(6-oxohexyl)phenoxy]butanoate;methanol;methyl 4-[3-hept-6-ynyl-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate (PubChem CID 157379794) has the molecular formula C46H68O12 and a molecular weight of 813.04 g/mol. Its IUPAC name is ethyl 4-[2-(3-ethoxy-3-oxopropyl)-3-(6-oxohexyl)phenoxy]butanoate;methanol;methyl 4-[3-hept-6-ynyl-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate.
| Compound Name | ethyl 4-[2-(3-ethoxy-3-oxopropyl)-3-(6-oxohexyl)phenoxy]butanoate;methanol;methyl 4-[3-hept-6-ynyl-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 157379794 |
| Molecular Formula | C46H68O12 |
| Molecular Weight | 813.04 g/mol |
| Exact Mass | 812.47 |
| IUPAC Name | ethyl 4-[2-(3-ethoxy-3-oxopropyl)-3-(6-oxohexyl)phenoxy]butanoate;methanol;methyl 4-[3-hept-6-ynyl-2-(3-methoxy-3-oxopropyl)phenoxy]butanoate |
| SMILES | C#CCCCCCc1cccc(OCCCC(=O)OC)c1CCC(=O)OC.CCOC(=O)CCCOc1cccc(CCCCCC=O)c1CCC(=O)OCC.CO |
| InChI | InChI=1S/C23H34O6.C22H30O5.CH4O/c1-3-27-22(25)14-10-18-29-21-13-9-12-19(11-7-5-6-8-17-24)20(21)15-16-23(26)28-4-2;1-4-5-6-7-8-11-18-12-9-13-20(19(18)15-16-22(24)26-3)27-17-10-14-21(23)25-2;1-2/h9,12-13,17H,3-8,10-11,14-16,18H2,1-2H3;1,9,12-13H,5-8,10-11,14-17H2,2-3H3;2H,1H3 |
| InChIKey | BKSYZADDIMBNSC-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.04 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|