C15H23F3O3Si — CID 90170863
triethoxy-[3-(2,4,6-trifluorophenyl)propyl]silane (PubChem CID 90170863) has the molecular formula C15H23F3O3Si and a molecular weight of 336.43 g/mol. Its IUPAC name is triethoxy-[3-(2,4,6-trifluorophenyl)propyl]silane.
| Compound Name | triethoxy-[3-(2,4,6-trifluorophenyl)propyl]silane |
|---|---|
| PubChem CID | 90170863 |
| Molecular Formula | C15H23F3O3Si |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | triethoxy-[3-(2,4,6-trifluorophenyl)propyl]silane |
| SMILES | CCO[Si](CCCc1c(F)cc(F)cc1F)(OCC)OCC |
| InChI | InChI=1S/C15H23F3O3Si/c1-4-19-22(20-5-2,21-6-3)9-7-8-13-14(17)10-12(16)11-15(13)18/h10-11H,4-9H2,1-3H3 |
| InChIKey | DIORJQQFSOBRJN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|