C42H72N2O6Si2 — CID 155602682
triethoxy-[9-[6-(9-triethoxysilylnonyl)-1,10-phenanthrolin-5-yl]nonyl]silane (PubChem CID 155602682) has the molecular formula C42H72N2O6Si2 and a molecular weight of 757.22 g/mol. Its IUPAC name is triethoxy-[9-[6-(9-triethoxysilylnonyl)-1,10-phenanthrolin-5-yl]nonyl]silane.
| Compound Name | triethoxy-[9-[6-(9-triethoxysilylnonyl)-1,10-phenanthrolin-5-yl]nonyl]silane |
|---|---|
| PubChem CID | 155602682 |
| Molecular Formula | C42H72N2O6Si2 |
| Molecular Weight | 757.22 g/mol |
| Exact Mass | 756.49 |
| IUPAC Name | triethoxy-[9-[6-(9-triethoxysilylnonyl)-1,10-phenanthrolin-5-yl]nonyl]silane |
| SMILES | CCO[Si](CCCCCCCCCc1c(CCCCCCCCC[Si](OCC)(OCC)OCC)c2cccnc2c2ncccc12)(OCC)OCC |
| InChI | InChI=1S/C42H72N2O6Si2/c1-7-45-51(46-8-2,47-9-3)35-25-21-17-13-15-19-23-29-37-38(40-32-28-34-44-42(40)41-39(37)31-27-33-43-41)30-24-20-16-14-18-22-26-36-52(48-10-4,49-11-5)50-12-6/h27-28,31-34H,7-26,29-30,35-36H2,1-6H3 |
| InChIKey | RJCYOWGEFNPNAJ-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.22 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|