C25H38O4SSi2 — CID 11049257
8-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one (PubChem CID 11049257) has the molecular formula C25H38O4SSi2 and a molecular weight of 490.81 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one.
| Compound Name | 8-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
|---|---|
| PubChem CID | 11049257 |
| Molecular Formula | C25H38O4SSi2 |
| Molecular Weight | 490.81 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 8-(benzenesulfonyl)-7-[tert-butyl(dimethyl)silyl]oxy-3-trimethylsilyl-4,5,6,7-tetrahydro-1H-azulen-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCCC2=C([Si](C)(C)C)C(=O)CC2=C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H38O4SSi2/c1-25(2,3)32(7,8)29-22-16-12-15-19-20(17-21(26)24(19)31(4,5)6)23(22)30(27,28)18-13-10-9-11-14-18/h9-11,13-14,22H,12,15-17H2,1-8H3 |
| InChIKey | ISVUWYBIIKJZSR-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.81 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|