C29H52O5SSi2 — CID 10698264
(E,2R,7R)-3-(benzenesulfonyl)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethylnon-5-en-4-one (PubChem CID 10698264) has the molecular formula C29H52O5SSi2 and a molecular weight of 568.97 g/mol. Its IUPAC name is (E,2R,7R)-3-(benzenesulfonyl)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethylnon-5-en-4-one.
| Compound Name | (E,2R,7R)-3-(benzenesulfonyl)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethylnon-5-en-4-one |
|---|---|
| PubChem CID | 10698264 |
| Molecular Formula | C29H52O5SSi2 |
| Molecular Weight | 568.97 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | (E,2R,7R)-3-(benzenesulfonyl)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethylnon-5-en-4-one |
| SMILES | CC[C@@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/C(=O)C([C@H](C)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H52O5SSi2/c1-14-26(34-37(12,13)29(7,8)9)22(2)20-25(30)27(35(31,32)24-18-16-15-17-19-24)23(3)21-33-36(10,11)28(4,5)6/h15-20,23,26-27H,14,21H2,1-13H3/b22-20+/t23-,26-,27?/m1/s1 |
| InChIKey | VYDCRTOXEQETGJ-AWVGTHFCSA-N |
| XLogP | 7.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.97 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|