C17H24O4SSi — CID 11110960
(4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one (PubChem CID 11110960) has the molecular formula C17H24O4SSi and a molecular weight of 352.53 g/mol. Its IUPAC name is (4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one.
| Compound Name | (4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11110960 |
| Molecular Formula | C17H24O4SSi |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C(S(=O)(=O)c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C17H24O4SSi/c1-17(2,3)23(4,5)21-13-11-15(18)16(12-13)22(19,20)14-9-7-6-8-10-14/h6-10,12-13H,11H2,1-5H3/t13-/m0/s1 |
| InChIKey | SHVMGWMLYBFLRT-ZDUSSCGKSA-N |
| XLogP | 3.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|