C23H40O4SSi2 — CID 5133448
[2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 5133448) has the molecular formula C23H40O4SSi2 and a molecular weight of 468.81 g/mol. Its IUPAC name is [2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 5133448 |
| Molecular Formula | C23H40O4SSi2 |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | [2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxycyclopent-2-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1C=C(S(=O)(=O)c2ccccc2)C(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C23H40O4SSi2/c1-22(2,3)29(7,8)26-18-16-20(27-30(9,10)23(4,5)6)21(17-18)28(24,25)19-14-12-11-13-15-19/h11-15,17-18,20H,16H2,1-10H3 |
| InChIKey | AJFFLMOSPMHLIS-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|