C30H54O6SSi3 — CID 10675445
(4S,5S,6R)-2-(benzenesulfonyl)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-one (PubChem CID 10675445) has the molecular formula C30H54O6SSi3 and a molecular weight of 627.08 g/mol. Its IUPAC name is (4S,5S,6R)-2-(benzenesulfonyl)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-one.
| Compound Name | (4S,5S,6R)-2-(benzenesulfonyl)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10675445 |
| Molecular Formula | C30H54O6SSi3 |
| Molecular Weight | 627.08 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | (4S,5S,6R)-2-(benzenesulfonyl)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]cyclohex-2-en-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C=C(S(=O)(=O)c2ccccc2)C(=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H54O6SSi3/c1-28(2,3)38(10,11)34-23-21-24(37(32,33)22-19-17-16-18-20-22)25(31)27(36-40(14,15)30(7,8)9)26(23)35-39(12,13)29(4,5)6/h16-21,23,26-27H,1-15H3/t23-,26-,27-/m0/s1 |
| InChIKey | YJPMVUPYZWVCCG-YGPDHOBYSA-N |
| XLogP | 8.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.08 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|