C17H26O5SSi — CID 10248611
1-[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]ethanone (PubChem CID 10248611) has the molecular formula C17H26O5SSi and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]ethanone.
| Compound Name | 1-[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]ethanone |
|---|---|
| PubChem CID | 10248611 |
| Molecular Formula | C17H26O5SSi |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]ethanone |
| SMILES | CC(=O)[C@]1(S(=O)(=O)c2ccccc2)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H26O5SSi/c1-13(18)17(23(19,20)14-10-8-7-9-11-14)15(22-17)12-21-24(5,6)16(2,3)4/h7-11,15H,12H2,1-6H3/t15-,17-/m1/s1 |
| InChIKey | JIBWFLCUEIKKDL-NVXWUHKLSA-N |
| XLogP | 3.17 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|