C18H30O4SSi — CID 10926778
[(1R)-1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]butoxy]-tert-butyl-dimethylsilane (PubChem CID 10926778) has the molecular formula C18H30O4SSi and a molecular weight of 370.59 g/mol. Its IUPAC name is [(1R)-1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]butoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R)-1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]butoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10926778 |
| Molecular Formula | C18H30O4SSi |
| Molecular Weight | 370.59 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(1R)-1-[(2R,3R)-3-(benzenesulfonyl)oxiran-2-yl]butoxy]-tert-butyl-dimethylsilane |
| SMILES | CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H30O4SSi/c1-7-11-15(22-24(5,6)18(2,3)4)16-17(21-16)23(19,20)14-12-9-8-10-13-14/h8-10,12-13,15-17H,7,11H2,1-6H3/t15-,16-,17-/m1/s1 |
| InChIKey | XULRSYKSRUURBN-BRWVUGGUSA-N |
| XLogP | 4.38 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|