C20H32O5SSi — CID 10341618
1-[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 10341618) has the molecular formula C20H32O5SSi and a molecular weight of 412.62 g/mol. Its IUPAC name is 1-[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 10341618 |
| Molecular Formula | C20H32O5SSi |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[(2S,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[C@]1(S(=O)(=O)c2ccccc2)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O5SSi/c1-18(2,3)17(21)20(26(22,23)15-12-10-9-11-13-15)16(25-20)14-24-27(7,8)19(4,5)6/h9-13,16H,14H2,1-8H3/t16-,20+/m1/s1 |
| InChIKey | CSKVWLRLYKCXFJ-UZLBHIALSA-N |
| XLogP | 4.19 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|