C21H36O4SSi — CID 14940919
[(1S)-1-[(2S)-2-(benzenesulfonyl)oxiran-2-yl]butoxy]-tri(propan-2-yl)silane (PubChem CID 14940919) has the molecular formula C21H36O4SSi and a molecular weight of 412.67 g/mol. Its IUPAC name is [(1S)-1-[(2S)-2-(benzenesulfonyl)oxiran-2-yl]butoxy]-tri(propan-2-yl)silane.
| Compound Name | [(1S)-1-[(2S)-2-(benzenesulfonyl)oxiran-2-yl]butoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 14940919 |
| Molecular Formula | C21H36O4SSi |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [(1S)-1-[(2S)-2-(benzenesulfonyl)oxiran-2-yl]butoxy]-tri(propan-2-yl)silane |
| SMILES | CCC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@]1(S(=O)(=O)c2ccccc2)CO1 |
| InChI | InChI=1S/C21H36O4SSi/c1-8-12-20(25-27(16(2)3,17(4)5)18(6)7)21(15-24-21)26(22,23)19-13-10-9-11-14-19/h9-11,13-14,16-18,20H,8,12,15H2,1-7H3/t20-,21-/m0/s1 |
| InChIKey | YXDADYZJAZGCQB-SFTDATJTSA-N |
| XLogP | 5.55 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|