C19H30O6SSi — CID 134953576
ethyl (2R,4R)-2-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetane-2-carboxylate (PubChem CID 134953576) has the molecular formula C19H30O6SSi and a molecular weight of 414.60 g/mol. Its IUPAC name is ethyl (2R,4R)-2-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetane-2-carboxylate.
| Compound Name | ethyl (2R,4R)-2-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetane-2-carboxylate |
|---|---|
| PubChem CID | 134953576 |
| Molecular Formula | C19H30O6SSi |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | ethyl (2R,4R)-2-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]oxetane-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(S(=O)(=O)c2ccccc2)C[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H30O6SSi/c1-7-23-17(20)19(26(21,22)16-11-9-8-10-12-16)13-15(25-19)14-24-27(5,6)18(2,3)4/h8-12,15H,7,13-14H2,1-6H3/t15-,19-/m1/s1 |
| InChIKey | FYPSASWHMYGJTR-DNVCBOLYSA-N |
| XLogP | 3.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|