C22H36O5SSi — CID 11761987
tert-butyl 3-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enoate (PubChem CID 11761987) has the molecular formula C22H36O5SSi and a molecular weight of 440.68 g/mol. Its IUPAC name is tert-butyl 3-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enoate.
| Compound Name | tert-butyl 3-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enoate |
|---|---|
| PubChem CID | 11761987 |
| Molecular Formula | C22H36O5SSi |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | tert-butyl 3-(benzenesulfonyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enoate |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C(CC(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H36O5SSi/c1-17(16-26-29(8,9)22(5,6)7)19(15-20(23)27-21(2,3)4)28(24,25)18-13-11-10-12-14-18/h10-14,19H,1,15-16H2,2-9H3 |
| InChIKey | FEZOGFYWNCKRPB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|