C18H22O4S — CID 10980553
(5E,9E)-3-(benzenesulfonyl)-5,9-dimethyl-1-oxacycloundeca-5,9-dien-2-one (PubChem CID 10980553) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is (5E,9E)-3-(benzenesulfonyl)-5,9-dimethyl-1-oxacycloundeca-5,9-dien-2-one.
| Compound Name | (5E,9E)-3-(benzenesulfonyl)-5,9-dimethyl-1-oxacycloundeca-5,9-dien-2-one |
|---|---|
| PubChem CID | 10980553 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (5E,9E)-3-(benzenesulfonyl)-5,9-dimethyl-1-oxacycloundeca-5,9-dien-2-one |
| SMILES | C/C1=C\COC(=O)C(S(=O)(=O)c2ccccc2)C/C(C)=C/CC1 |
| InChI | InChI=1S/C18H22O4S/c1-14-7-6-8-15(2)13-17(18(19)22-12-11-14)23(20,21)16-9-4-3-5-10-16/h3-5,8-11,17H,6-7,12-13H2,1-2H3/b14-11+,15-8+ |
| InChIKey | LDTCZMULKMRRTB-GGQZXFEVSA-N |
| XLogP | 3.45 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|