C21H34O5SSi — CID 11362335
[(E,3S,6S)-1-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-3-yl] acetate (PubChem CID 11362335) has the molecular formula C21H34O5SSi and a molecular weight of 426.65 g/mol. Its IUPAC name is [(E,3S,6S)-1-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-3-yl] acetate.
| Compound Name | [(E,3S,6S)-1-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 11362335 |
| Molecular Formula | C21H34O5SSi |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [(E,3S,6S)-1-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-en-3-yl] acetate |
| SMILES | CC(=O)O[C@H](/C=C/S(=O)(=O)c1ccccc1)CC[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O5SSi/c1-17(26-28(6,7)21(3,4)5)13-14-19(25-18(2)22)15-16-27(23,24)20-11-9-8-10-12-20/h8-12,15-17,19H,13-14H2,1-7H3/b16-15+/t17-,19-/m0/s1 |
| InChIKey | LGNDDDXTCGPGKA-MAPZISFRSA-N |
| XLogP | 5.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|