C18H30O5SSi — CID 11058149
methyl (4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxypentanoate (PubChem CID 11058149) has the molecular formula C18H30O5SSi and a molecular weight of 386.59 g/mol. Its IUPAC name is methyl (4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxypentanoate.
| Compound Name | methyl (4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxypentanoate |
|---|---|
| PubChem CID | 11058149 |
| Molecular Formula | C18H30O5SSi |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | methyl (4S)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxypentanoate |
| SMILES | COC(=O)C(C[C@H](C)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H30O5SSi/c1-14(23-25(6,7)18(2,3)4)13-16(17(19)22-5)24(20,21)15-11-9-8-10-12-15/h8-12,14,16H,13H2,1-7H3/t14-,16?/m0/s1 |
| InChIKey | BLQMTGVFSHRRSY-LBAUFKAWSA-N |
| XLogP | 3.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|