C19H30O5SSi — CID 102238800
methyl (3S)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enoate (PubChem CID 102238800) has the molecular formula C19H30O5SSi and a molecular weight of 398.60 g/mol. Its IUPAC name is methyl (3S)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enoate.
| Compound Name | methyl (3S)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enoate |
|---|---|
| PubChem CID | 102238800 |
| Molecular Formula | C19H30O5SSi |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | methyl (3S)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pent-4-enoate |
| SMILES | C=C[C@@H](CO[Si](C)(C)C(C)(C)C)C(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H30O5SSi/c1-8-15(14-24-26(6,7)19(2,3)4)17(18(20)23-5)25(21,22)16-12-10-9-11-13-16/h8-13,15,17H,1,14H2,2-7H3/t15-,17?/m0/s1 |
| InChIKey | KTYHWVYXSCBGHY-MYJWUSKBSA-N |
| XLogP | 3.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|