C15H22O6S — CID 11727248
methyl (3S,4R)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3-methylpentanoate (PubChem CID 11727248) has the molecular formula C15H22O6S and a molecular weight of 330.40 g/mol. Its IUPAC name is methyl (3S,4R)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3-methylpentanoate.
| Compound Name | methyl (3S,4R)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3-methylpentanoate |
|---|---|
| PubChem CID | 11727248 |
| Molecular Formula | C15H22O6S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | methyl (3S,4R)-2-(benzenesulfonyl)-4-(methoxymethoxy)-3-methylpentanoate |
| SMILES | COCO[C@H](C)[C@H](C)C(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22O6S/c1-11(12(2)21-10-19-3)14(15(16)20-4)22(17,18)13-8-6-5-7-9-13/h5-9,11-12,14H,10H2,1-4H3/t11-,12+,14?/m0/s1 |
| InChIKey | XKTGPTVHCXUMQT-KTYPHDMWSA-N |
| XLogP | 1.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|