C23H30O4SSi — CID 53304615
ethyl (E)-6-(benzenesulfonyl)-4-[[dimethyl(phenyl)silyl]methyl]hex-5-enoate (PubChem CID 53304615) has the molecular formula C23H30O4SSi and a molecular weight of 430.64 g/mol. Its IUPAC name is ethyl (E)-6-(benzenesulfonyl)-4-[[dimethyl(phenyl)silyl]methyl]hex-5-enoate.
| Compound Name | ethyl (E)-6-(benzenesulfonyl)-4-[[dimethyl(phenyl)silyl]methyl]hex-5-enoate |
|---|---|
| PubChem CID | 53304615 |
| Molecular Formula | C23H30O4SSi |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | ethyl (E)-6-(benzenesulfonyl)-4-[[dimethyl(phenyl)silyl]methyl]hex-5-enoate |
| SMILES | CCOC(=O)CCC(/C=C/S(=O)(=O)c1ccccc1)C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H30O4SSi/c1-4-27-23(24)16-15-20(19-29(2,3)22-13-9-6-10-14-22)17-18-28(25,26)21-11-7-5-8-12-21/h5-14,17-18,20H,4,15-16,19H2,1-3H3/b18-17+ |
| InChIKey | FAIWQBZTPUBRND-ISLYRVAYSA-N |
| XLogP | 4.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|