C18H18O6S2 — CID 102289011
3-[2,2-bis(benzenesulfonyl)ethyl]oxolan-2-one (PubChem CID 102289011) has the molecular formula C18H18O6S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-[2,2-bis(benzenesulfonyl)ethyl]oxolan-2-one.
| Compound Name | 3-[2,2-bis(benzenesulfonyl)ethyl]oxolan-2-one |
|---|---|
| PubChem CID | 102289011 |
| Molecular Formula | C18H18O6S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 3-[2,2-bis(benzenesulfonyl)ethyl]oxolan-2-one |
| SMILES | O=C1OCCC1CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18O6S2/c19-18-14(11-12-24-18)13-17(25(20,21)15-7-3-1-4-8-15)26(22,23)16-9-5-2-6-10-16/h1-10,14,17H,11-13H2 |
| InChIKey | AJQSWADTEVCLBY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |