C19H30O6SSi — CID 101209160
ethyl 3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxo(313C)pentanoate (PubChem CID 101209160) has the molecular formula C19H30O6SSi and a molecular weight of 415.59 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxo(313C)pentanoate.
| Compound Name | ethyl 3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxo(313C)pentanoate |
|---|---|
| PubChem CID | 101209160 |
| Molecular Formula | C19H30O6SSi |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl 3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-4-oxo(313C)pentanoate |
| SMILES | CCOC(=O)C[13CH](C(=O)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H30O6SSi/c1-7-24-18(21)13-17(26(22,23)15-11-9-8-10-12-15)16(20)14-25-27(5,6)19(2,3)4/h8-12,17H,7,13-14H2,1-6H3/i17+1 |
| InChIKey | HKWKGONENNCGAG-CAAGJAQSSA-N |
| XLogP | 3.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|