C21H34O6SSi — CID 11744092
ethyl (5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(4-methylphenyl)sulfonyl-2-oxohexanoate (PubChem CID 11744092) has the molecular formula C21H34O6SSi and a molecular weight of 442.65 g/mol. Its IUPAC name is ethyl (5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(4-methylphenyl)sulfonyl-2-oxohexanoate.
| Compound Name | ethyl (5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(4-methylphenyl)sulfonyl-2-oxohexanoate |
|---|---|
| PubChem CID | 11744092 |
| Molecular Formula | C21H34O6SSi |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | ethyl (5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(4-methylphenyl)sulfonyl-2-oxohexanoate |
| SMILES | CCOC(=O)C(=O)C(C[C@H](C)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H34O6SSi/c1-9-26-20(23)19(22)18(14-16(3)27-29(7,8)21(4,5)6)28(24,25)17-12-10-15(2)11-13-17/h10-13,16,18H,9,14H2,1-8H3/t16-,18?/m0/s1 |
| InChIKey | JFBOZISWSGRNDL-ATNAJCNCSA-N |
| XLogP | 4.07 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|