C22H38O4SSi — CID 10365166
(8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-(4-methylphenyl)sulfonylnonan-4-one (PubChem CID 10365166) has the molecular formula C22H38O4SSi and a molecular weight of 426.70 g/mol. Its IUPAC name is (8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-(4-methylphenyl)sulfonylnonan-4-one.
| Compound Name | (8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-(4-methylphenyl)sulfonylnonan-4-one |
|---|---|
| PubChem CID | 10365166 |
| Molecular Formula | C22H38O4SSi |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | (8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-(4-methylphenyl)sulfonylnonan-4-one |
| SMILES | CCCC(=O)C(CC[C@H](C)O[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H38O4SSi/c1-9-10-20(23)21(27(24,25)19-14-11-17(2)12-15-19)16-13-18(3)26-28(7,8)22(4,5)6/h11-12,14-15,18,21H,9-10,13,16H2,1-8H3/t18-,21?/m0/s1 |
| InChIKey | VEUZWBBBANSJHH-YMXDCFFPSA-N |
| XLogP | 5.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|