C26H46O4SSi2 — CID 11598697
trans-(4S,5R)-2-(benzenesulfinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-triethylsilyloxyethyl)cyclohexan-1-one (PubChem CID 11598697) has the molecular formula C26H46O4SSi2 and a molecular weight of 510.89 g/mol. Its IUPAC name is trans-(4S,5R)-2-(benzenesulfinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-triethylsilyloxyethyl)cyclohexan-1-one.
| Compound Name | trans-(4S,5R)-2-(benzenesulfinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-triethylsilyloxyethyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11598697 |
| Molecular Formula | C26H46O4SSi2 |
| Molecular Weight | 510.89 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | trans-(4S,5R)-2-(benzenesulfinyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-(2-triethylsilyloxyethyl)cyclohexan-1-one |
| SMILES | CC[Si](CC)(CC)OCC[C@@H]1CC(=O)C(S(=O)c2ccccc2)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H46O4SSi2/c1-9-33(10-2,11-3)29-18-17-21-19-23(27)25(31(28)22-15-13-12-14-16-22)20-24(21)30-32(7,8)26(4,5)6/h12-16,21,24-25H,9-11,17-20H2,1-8H3/t21-,24+,25?,31?/m1/s1 |
| InChIKey | YZJYQLFXYAENNU-URBITGCXSA-N |
| XLogP | 6.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.89 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|