C20H32O4SSi — CID 11395377
trans-(3R,4R)-3-(benzenesulfonylmethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexan-1-one (PubChem CID 11395377) has the molecular formula C20H32O4SSi and a molecular weight of 396.63 g/mol. Its IUPAC name is trans-(3R,4R)-3-(benzenesulfonylmethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexan-1-one.
| Compound Name | trans-(3R,4R)-3-(benzenesulfonylmethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 11395377 |
| Molecular Formula | C20H32O4SSi |
| Molecular Weight | 396.63 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | trans-(3R,4R)-3-(benzenesulfonylmethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CCC(=O)C[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H32O4SSi/c1-20(2,3)26(4,5)24-14-16-11-12-18(21)13-17(16)15-25(22,23)19-9-7-6-8-10-19/h6-10,16-17H,11-15H2,1-5H3/t16-,17-/m0/s1 |
| InChIKey | RFWAXVIXFSTFSK-IRXDYDNUSA-N |
| XLogP | 4.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|