C18H26O6S — CID 134983535
3-[1-(benzenesulfonyl)-3,3,3-trimethoxypropyl]cyclohexan-1-one (PubChem CID 134983535) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)-3,3,3-trimethoxypropyl]cyclohexan-1-one.
| Compound Name | 3-[1-(benzenesulfonyl)-3,3,3-trimethoxypropyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 134983535 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 3-[1-(benzenesulfonyl)-3,3,3-trimethoxypropyl]cyclohexan-1-one |
| SMILES | COC(CC(C1CCCC(=O)C1)S(=O)(=O)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C18H26O6S/c1-22-18(23-2,24-3)13-17(14-8-7-9-15(19)12-14)25(20,21)16-10-5-4-6-11-16/h4-6,10-11,14,17H,7-9,12-13H2,1-3H3 |
| InChIKey | GMGQTJLNOTVSSC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|