C23H32O4SSi — CID 134864914
(1S,2R,6S,10S)-2-(benzenesulfonyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]tricyclo[4.4.0.02,10]dec-7-en-3-one (PubChem CID 134864914) has the molecular formula C23H32O4SSi and a molecular weight of 432.66 g/mol. Its IUPAC name is (1S,2R,6S,10S)-2-(benzenesulfonyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]tricyclo[4.4.0.02,10]dec-7-en-3-one.
| Compound Name | (1S,2R,6S,10S)-2-(benzenesulfonyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]tricyclo[4.4.0.02,10]dec-7-en-3-one |
|---|---|
| PubChem CID | 134864914 |
| Molecular Formula | C23H32O4SSi |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (1S,2R,6S,10S)-2-(benzenesulfonyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]tricyclo[4.4.0.02,10]dec-7-en-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]12C=CC[C@H]3[C@@H]1[C@@]3(S(=O)(=O)c1ccccc1)C(=O)CC2 |
| InChI | InChI=1S/C23H32O4SSi/c1-21(2,3)29(4,5)27-16-22-14-9-12-18-20(22)23(18,19(24)13-15-22)28(25,26)17-10-7-6-8-11-17/h6-11,14,18,20H,12-13,15-16H2,1-5H3/t18-,20-,22-,23-/m0/s1 |
| InChIKey | JPYBVYSHWWMVSB-HMNCIZAVSA-N |
| XLogP | 4.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|